cas: 168892-66-8 — see every product listed under this CAS number, including other names
4-(2-((tert-Butoxycarbonyl)amino)ethoxy)benzoic acid, 98% (CAS 168892-66-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A592713-10g |
| cas | 168892-66-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6417.25 Pln | |
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 1g | 1065.27 Pln | |
| Fluorochem | 5g | 3028.12 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid (CAS 168892-66-8) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid. InChIKey: COIQSXDNBXSYMY-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]benzoic acid |
| InChIKey | COIQSXDNBXSYMY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)