4-(2-Bromoacetyl)benzene-1-sulfonamide, 95%
cas: 944-33-2 — see every product listed under this CAS number, including other names
4-(2-Bromoacetyl)benzene-1-sulfonamide, 95% (CAS 944-33-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1107478-100mg |
| cas | 944-33-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 337.00 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1054.56 Pln | |
| Ambeed | 5g | 3018.12 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 1086.80 Pln | |
| BLDpharm | 100mg | 353.23 Pln | |
| BLDpharm | 250mg | 497.63 Pln | |
| BLDpharm | 1g | 1130.74 Pln | |
| BLDpharm | 5g | 3246.66 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-(2-bromoacetyl)benzenesulfonamide (CAS 944-33-2) is a chemical compound with the molecular formula C8H8BrNO3S and a molecular weight of 278.13 g/mol. IUPAC name: 4-(2-bromoacetyl)benzenesulfonamide. InChIKey: CYXRPWCLRVINRW-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3S |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | 4-(2-bromoacetyl)benzenesulfonamide |
| InChIKey | CYXRPWCLRVINRW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CBr)S(=O)(=O)N |
Computed by PubChem (NCBI)