CAS 89819-41-0 appears in our catalog under these names: 5-Bromo-2,3-dihydrobenzofuran-7-sulfonamide, 97%, 5-Bromo-2,3-dihydro-1-benzofuran-7-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-2,3-dihydro-1-benzofuran-7-sulfonamide (CAS 89819-41-0) is a chemical compound with the molecular formula C8H8BrNO3S and a molecular weight of 278.13 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1-benzofuran-7-sulfonamide. InChIKey: IUVSHLZWEWQVIH-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3S |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1-benzofuran-7-sulfonamide |
| InChIKey | IUVSHLZWEWQVIH-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2S(=O)(=O)N)Br |
Computed by PubChem (NCBI)