Products 847781-96-8

CAS 847781-96-8 is the registry number for 2-({(1-(5-bromothiophen-2-yl)ethylidene)amino}oxy)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-[(E)-1-(5-bromothiophen-2-yl)ethylideneamino]oxyacetic acid (CAS 847781-96-8) is a chemical compound with the molecular formula C8H8BrNO3S and a molecular weight of 278.13 g/mol. IUPAC name: 2-[(E)-1-(5-bromothiophen-2-yl)ethylideneamino]oxyacetic acid. InChIKey: FXIPDCZHJVTWHX-BJMVGYQFSA-N.

Identity
Molecular formulaC8H8BrNO3S
Molecular weight278.13 g/mol
IUPAC name2-[(E)-1-(5-bromothiophen-2-yl)ethylideneamino]oxyacetic acid
InChIKeyFXIPDCZHJVTWHX-BJMVGYQFSA-N
SMILESC/C(=N\OCC(=O)O)/C1=CC=C(S1)Br

Computed by PubChem (NCBI)