CAS 847781-96-8 is the registry number for 2-({(1-(5-bromothiophen-2-yl)ethylidene)amino}oxy)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[(E)-1-(5-bromothiophen-2-yl)ethylideneamino]oxyacetic acid (CAS 847781-96-8) is a chemical compound with the molecular formula C8H8BrNO3S and a molecular weight of 278.13 g/mol. IUPAC name: 2-[(E)-1-(5-bromothiophen-2-yl)ethylideneamino]oxyacetic acid. InChIKey: FXIPDCZHJVTWHX-BJMVGYQFSA-N.
| Molecular formula | C8H8BrNO3S |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | 2-[(E)-1-(5-bromothiophen-2-yl)ethylideneamino]oxyacetic acid |
| InChIKey | FXIPDCZHJVTWHX-BJMVGYQFSA-N |
| SMILES | C/C(=N\OCC(=O)O)/C1=CC=C(S1)Br |
Computed by PubChem (NCBI)