CAS 1207747-40-7 appears in our catalog under these names: 2-Bromo-1-(6-methanesulfonylpyridin-3-yl)ethan-1-one, 2-Bromo-1-(6-methanesulfonylpyridin-3-yl)ethan-1-one, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
2-bromo-1-(6-methylsulfonyl-3-pyridinyl)ethanone (CAS 1207747-40-7) is a chemical compound with the molecular formula C8H8BrNO3S and a molecular weight of 278.13 g/mol. IUPAC name: 2-bromo-1-(6-methylsulfonyl-3-pyridinyl)ethanone. InChIKey: SXACKVTVLIPSDZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3S |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | 2-bromo-1-(6-methylsulfonyl-3-pyridinyl)ethanone |
| InChIKey | SXACKVTVLIPSDZ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC=C(C=C1)C(=O)CBr |
Computed by PubChem (NCBI)