CAS 152675-32-6 is the registry number for N-(4-Bromobenzenesulfonyl)acetamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
N-(4-bromophenyl)sulfonylacetamide (CAS 152675-32-6) is a chemical compound with the molecular formula C8H8BrNO3S and a molecular weight of 278.13 g/mol. IUPAC name: N-(4-bromophenyl)sulfonylacetamide. InChIKey: GUSSBUVTIMQOBB-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3S |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | N-(4-bromophenyl)sulfonylacetamide |
| InChIKey | GUSSBUVTIMQOBB-UHFFFAOYSA-N |
| SMILES | CC(=O)NS(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)