CAS 1363593-70-7 appears in our catalog under these names: 8-Bromo-3,4-dihydro-2H-benzo(b)(1,4,5)oxathiazepine 1,1-dioxide, 97%, 8-BROMO-3,4-DIHYDRO-2H-5,1LAMBDA6,2-BENZOXATHIAZEPINE-1,1-DIONE, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
8-bromo-3,4-dihydro-2H-5,1lambda6,2-benzoxathiazepine 1,1-dioxide (CAS 1363593-70-7) is a chemical compound with the molecular formula C8H8BrNO3S and a molecular weight of 278.13 g/mol. IUPAC name: 8-bromo-3,4-dihydro-2H-5,1lambda6,2-benzoxathiazepine 1,1-dioxide. InChIKey: LASIMURTOVOHMC-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO3S |
|---|---|
| Molecular weight | 278.13 g/mol |
| IUPAC name | 8-bromo-3,4-dihydro-2H-5,1lambda6,2-benzoxathiazepine 1,1-dioxide |
| InChIKey | LASIMURTOVOHMC-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C=C2)Br)S(=O)(=O)N1 |
Computed by PubChem (NCBI)