cas: 101681-34-9 — see every product listed under this CAS number, including other names
4-(2-Bromophenyl)pyridine 98% (CAS 101681-34-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A572913-100mg |
| cas | 101681-34-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 609.56 Pln | |
| Ambeed | 1g | 1532.94 Pln | |
| Ambeed | 5g | 5226.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A572913 |
4-(2-bromophenyl)pyridine (CAS 101681-34-9) is a chemical compound with the molecular formula C11H8BrN and a molecular weight of 234.09 g/mol. IUPAC name: 4-(2-bromophenyl)pyridine. InChIKey: GZZVURXUOZUXDO-UHFFFAOYSA-N.
| Molecular formula | C11H8BrN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | 4-(2-bromophenyl)pyridine |
| InChIKey | GZZVURXUOZUXDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=NC=C2)Br |
Computed by PubChem (NCBI)