4-(2-Hydroxypropan-2-yl)furan-2-sulfonamide, 98%
cas: 210827-34-2 — see every product listed under this CAS number, including other names
4-(2-Hydroxypropan-2-yl)furan-2-sulfonamide, 98% (CAS 210827-34-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1070683-250mg |
| cas | 210827-34-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2600.94 Pln | |
| Ambeed | 10g | 4041.63 Pln | |
| BLDpharm | 250mg | 269.93 Pln | |
| BLDpharm | 1g | 803.08 Pln | |
| BLDpharm | 5g | 2796.82 Pln | |
| BLDpharm | 10g | 4357.38 Pln | |
| Fluorochem | 100mg | 200.99 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 768.50 Pln | |
| Fluorochem | 5g | 2679.28 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-(2-hydroxypropan-2-yl)furan-2-sulfonamide (CAS 210827-34-2) is a chemical compound with the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. IUPAC name: 4-(2-hydroxypropan-2-yl)furan-2-sulfonamide. InChIKey: RZNNEQHIXCRCKM-UHFFFAOYSA-N.
| Molecular formula | C7H11NO4S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 4-(2-hydroxypropan-2-yl)furan-2-sulfonamide |
| InChIKey | RZNNEQHIXCRCKM-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=COC(=C1)S(=O)(=O)N)O |
Computed by PubChem (NCBI)