Products 74401-71-1
CAS 74401-71-1 appears in our catalog under these names: Acetylcysteine Impurity 24, (R)-2-(N-acetylacetamido)-3-mercaptopropanoic acid, Acetylcysteine Impurity 30. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R)-2-(diacetylamino)-3-sulfanylpropanoic acid (CAS 74401-71-1) is a chemical compound with the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. IUPAC name: (2R)-2-(diacetylamino)-3-sulfanylpropanoic acid. InChIKey: BSWPGDZSMHQEBE-LURJTMIESA-N.
| Molecular formula | C7H11NO4S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | (2R)-2-(diacetylamino)-3-sulfanylpropanoic acid |
| InChIKey | BSWPGDZSMHQEBE-LURJTMIESA-N |
| SMILES | CC(=O)N([C@@H](CS)C(=O)O)C(=O)C |
Computed by PubChem (NCBI)