Products 1795785-99-7

CAS 1795785-99-7 is the registry number for Acetylcysteine Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-acetamido-3-acetylsulfanylpropanoic acid (CAS 1795785-99-7) is a chemical compound with the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. IUPAC name: (2S)-2-acetamido-3-acetylsulfanylpropanoic acid. InChIKey: HSPYGHDTVQJUDE-ZCFIWIBFSA-N.

Identity
Molecular formulaC7H11NO4S
Molecular weight205.23 g/mol
IUPAC name(2S)-2-acetamido-3-acetylsulfanylpropanoic acid
InChIKeyHSPYGHDTVQJUDE-ZCFIWIBFSA-N
SMILESCC(=O)N[C@H](CSC(=O)C)C(=O)O

Computed by PubChem (NCBI)