CAS 1795785-99-7 is the registry number for Acetylcysteine Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-acetamido-3-acetylsulfanylpropanoic acid (CAS 1795785-99-7) is a chemical compound with the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. IUPAC name: (2S)-2-acetamido-3-acetylsulfanylpropanoic acid. InChIKey: HSPYGHDTVQJUDE-ZCFIWIBFSA-N.
| Molecular formula | C7H11NO4S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | (2S)-2-acetamido-3-acetylsulfanylpropanoic acid |
| InChIKey | HSPYGHDTVQJUDE-ZCFIWIBFSA-N |
| SMILES | CC(=O)N[C@H](CSC(=O)C)C(=O)O |
Computed by PubChem (NCBI)