CAS 1909325-24-1 is the registry number for Quinuclidine-3-carboxylic acid 2,2-dioxide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2,2-dioxo-2lambda6-thia-1-azabicyclo[2.2.2]octane-3-carboxylic acid (CAS 1909325-24-1) is a chemical compound with the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. IUPAC name: 2,2-dioxo-2lambda6-thia-1-azabicyclo[2.2.2]octane-3-carboxylic acid. InChIKey: BYDYRYRMUJAMLN-UHFFFAOYSA-N.
| Molecular formula | C7H11NO4S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 2,2-dioxo-2lambda6-thia-1-azabicyclo[2.2.2]octane-3-carboxylic acid |
| InChIKey | BYDYRYRMUJAMLN-UHFFFAOYSA-N |
| SMILES | C1CN2CCC1C(S2(=O)=O)C(=O)O |
Computed by PubChem (NCBI)