Products 1219827-77-6
CAS 1219827-77-6 appears in our catalog under these names: 1-(Cyclopropylsulfonyl)azetidine-3-carboxylic acid, 95%, 1-(cyclopropylsulfonyl)azetidine-3-carboxylic acid, 98%, 1-(Cyclopropanesulfonyl)azetidine-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 2,5g.
1-cyclopropylsulfonylazetidine-3-carboxylic acid (CAS 1219827-77-6) is a chemical compound with the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. IUPAC name: 1-cyclopropylsulfonylazetidine-3-carboxylic acid. InChIKey: KGCGCXUZKZKOII-UHFFFAOYSA-N.
| Molecular formula | C7H11NO4S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 1-cyclopropylsulfonylazetidine-3-carboxylic acid |
| InChIKey | KGCGCXUZKZKOII-UHFFFAOYSA-N |
| SMILES | C1CC1S(=O)(=O)N2CC(C2)C(=O)O |
Computed by PubChem (NCBI)