CAS 55212-69-6 is the registry number for Ethyl (1,1-dioxido-2,3-dihydrothiophen-3-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamate (CAS 55212-69-6) is a chemical compound with the molecular formula C7H11NO4S and a molecular weight of 205.23 g/mol. IUPAC name: ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamate. InChIKey: YBCQPYAIFHHIKE-UHFFFAOYSA-N.
| Molecular formula | C7H11NO4S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | ethyl N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)carbamate |
| InChIKey | YBCQPYAIFHHIKE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1CS(=O)(=O)C=C1 |
Computed by PubChem (NCBI)