cas: 935552-89-9 — see every product listed under this CAS number, including other names
4-(3,5-DiMethylphenyl)benzonitrile, 97%, 97% (CAS 935552-89-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IHO2-100mg |
| cas | 935552-89-9 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 1g | 491.60 Pln | |
| Chemat | 5g | 914.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(3,5-dimethylphenyl)benzonitrile (CAS 935552-89-9) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 4-(3,5-dimethylphenyl)benzonitrile. InChIKey: XRXGVDHXCUMXEW-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 4-(3,5-dimethylphenyl)benzonitrile |
| InChIKey | XRXGVDHXCUMXEW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC=C(C=C2)C#N)C |
Computed by PubChem (NCBI)