cas: 125043-83-6 — see every product listed under this CAS number, including other names
4-(3-Nitrophenoxy)piperidine hydrochloride, 97% (CAS 125043-83-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212247-1G |
| cas | 125043-83-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1403.69 Pln | |
| Fluorochem | 5g | 4111.07 Pln | |
| Fluorochem | 10g | 6750.77 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(3-nitrophenoxy)piperidine;hydrochloride (CAS 125043-83-6) is a chemical compound with the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. IUPAC name: 4-(3-nitrophenoxy)piperidine;hydrochloride. InChIKey: QZNVAZLSQUKSQN-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O3 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 4-(3-nitrophenoxy)piperidine;hydrochloride |
| InChIKey | QZNVAZLSQUKSQN-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC=CC(=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)