Products 264275-33-4

CAS 264275-33-4 is the registry number for (S)-Methyl 2-amino-3-benzamidopropanoate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g.

Structural formula: {0} (CAS {1})

Methyl (2S)-2-amino-3-benzamidopropanoate;hydrochloride (CAS 264275-33-4) is a chemical compound with the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. IUPAC name: methyl (2S)-2-amino-3-benzamidopropanoate;hydrochloride. InChIKey: RCXIHYHAQSRRSY-FVGYRXGTSA-N.

Identity
Molecular formulaC11H15ClN2O3
Molecular weight258.70 g/mol
IUPAC namemethyl (2S)-2-amino-3-benzamidopropanoate;hydrochloride
InChIKeyRCXIHYHAQSRRSY-FVGYRXGTSA-N
SMILESCOC(=O)[C@H](CNC(=O)C1=CC=CC=C1)N.Cl

Computed by PubChem (NCBI)