CAS 264275-33-4 is the registry number for (S)-Methyl 2-amino-3-benzamidopropanoate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g.
Methyl (2S)-2-amino-3-benzamidopropanoate;hydrochloride (CAS 264275-33-4) is a chemical compound with the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. IUPAC name: methyl (2S)-2-amino-3-benzamidopropanoate;hydrochloride. InChIKey: RCXIHYHAQSRRSY-FVGYRXGTSA-N.
| Molecular formula | C11H15ClN2O3 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-benzamidopropanoate;hydrochloride |
| InChIKey | RCXIHYHAQSRRSY-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CNC(=O)C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)