CAS 923155-67-3 is the registry number for 1-(Chloroacetyl)-1,4-diazaspiro[5.5]undecane-3,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
1-(2-chloroacetyl)-1,4-diazaspiro[5.5]undecane-3,5-dione (CAS 923155-67-3) is a chemical compound with the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. IUPAC name: 1-(2-chloroacetyl)-1,4-diazaspiro[5.5]undecane-3,5-dione. InChIKey: YQYBUNIJKFFJKB-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O3 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 1-(2-chloroacetyl)-1,4-diazaspiro[5.5]undecane-3,5-dione |
| InChIKey | YQYBUNIJKFFJKB-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C(=O)NC(=O)CN2C(=O)CCl |
Computed by PubChem (NCBI)