CAS 1072944-49-0 is the registry number for 4-(2-Nitrophenoxy)piperidine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
4-(2-nitrophenoxy)piperidine;hydrochloride (CAS 1072944-49-0) is a chemical compound with the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. IUPAC name: 4-(2-nitrophenoxy)piperidine;hydrochloride. InChIKey: JGIKYGXQGXORFY-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O3 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 4-(2-nitrophenoxy)piperidine;hydrochloride |
| InChIKey | JGIKYGXQGXORFY-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC=CC=C2[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)