CAS 125043-83-6 is the registry number for 4-(3-Nitrophenoxy)piperidine hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 1g.
4-(3-nitrophenoxy)piperidine;hydrochloride (CAS 125043-83-6) is a chemical compound with the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. IUPAC name: 4-(3-nitrophenoxy)piperidine;hydrochloride. InChIKey: QZNVAZLSQUKSQN-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O3 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 4-(3-nitrophenoxy)piperidine;hydrochloride |
| InChIKey | QZNVAZLSQUKSQN-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC=CC(=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)