CAS 63352-94-3 appears in our catalog under these names: 3–(Dimethylamino)–1–(3–nitrophenyl)propan–1–one hydrochloride, 3-(Dimethylamino)-1-(3-nitrophenyl)propan-1-one hydrochloride, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
3-(dimethylamino)-1-(3-nitrophenyl)propan-1-one;hydrochloride (CAS 63352-94-3) is a chemical compound with the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. IUPAC name: 3-(dimethylamino)-1-(3-nitrophenyl)propan-1-one;hydrochloride. InChIKey: ZFRBPOZPCGDGOU-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O3 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 3-(dimethylamino)-1-(3-nitrophenyl)propan-1-one;hydrochloride |
| InChIKey | ZFRBPOZPCGDGOU-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(=O)C1=CC(=CC=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)