cas: 5737-85-9 — see every product listed under this CAS number, including other names
4-(3-Nitrophenyl)benzoic acid, 97% (CAS 5737-85-9) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F636164-500MG |
| cas | 5737-85-9 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 950.72 Pln | |
| Fluorochem | 1g | 1403.69 Pln | |
| Fluorochem | 5g | 4183.96 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(3-nitrophenyl)benzoic acid (CAS 5737-85-9) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: 4-(3-nitrophenyl)benzoic acid. InChIKey: VTIDLRLMTWAWBF-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 4-(3-nitrophenyl)benzoic acid |
| InChIKey | VTIDLRLMTWAWBF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)