cas: 74248-66-1 — see every product listed under this CAS number, including other names
4-(3-oxobutyl)benzoic acid, 95%, 95% (CAS 74248-66-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DIHO-100mg |
| cas | 74248-66-1 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 890.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-(3-oxobutyl)benzoic acid (CAS 74248-66-1) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 4-(3-oxobutyl)benzoic acid. InChIKey: PJLBHTNCHZROBQ-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 4-(3-oxobutyl)benzoic acid |
| InChIKey | PJLBHTNCHZROBQ-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)