CAS 925441-90-3 is the registry number for 4-Formyl-3,5-dimethylphenyl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(4-formyl-3,5-dimethylphenyl) acetate (CAS 925441-90-3) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: (4-formyl-3,5-dimethylphenyl) acetate. InChIKey: MZOQUFCXOZAKQA-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | (4-formyl-3,5-dimethylphenyl) acetate |
| InChIKey | MZOQUFCXOZAKQA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C=O)C)OC(=O)C |
Computed by PubChem (NCBI)