cas: 90035-20-4 — see every product listed under this CAS number, including other names
4-(4-(Trifluoromethyl)phenoxy)benzaldehyde 95% (CAS 90035-20-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A189323-100mg |
| cas | 90035-20-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 1955.69 Pln | |
| Ambeed | 10g | 3212.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A189323 |
4-[4-(trifluoromethyl)phenoxy]benzaldehyde (CAS 90035-20-4) is a chemical compound with the molecular formula C14H9F3O2 and a molecular weight of 266.21 g/mol. IUPAC name: 4-[4-(trifluoromethyl)phenoxy]benzaldehyde. InChIKey: RFPORHXEHBGCCJ-UHFFFAOYSA-N.
| Molecular formula | C14H9F3O2 |
|---|---|
| Molecular weight | 266.21 g/mol |
| IUPAC name | 4-[4-(trifluoromethyl)phenoxy]benzaldehyde |
| InChIKey | RFPORHXEHBGCCJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)OC2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)