4-(4-Methoxyphenyl)-4-oxobut-2-enoic acid, 95%
cas: 5711-41-1 — see every product listed under this CAS number, including other names
4-(4-Methoxyphenyl)-4-oxobut-2-enoic acid, 95% (CAS 5711-41-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F243226-1G |
| cas | 5711-41-1 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 804.94 Pln | |
| Fluorochem | 10g | 1450.55 Pln | |
| Fluorochem | 25g | 2585.57 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 787.56 Pln | |
| Ambeed | 25g | 2517.50 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 286.59 Pln | |
| BLDpharm | 5g | 847.50 Pln | |
| BLDpharm | 25g | 2707.96 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(E)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid (CAS 5711-41-1) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: (E)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid. InChIKey: WORYXBDHTBWLLL-VOTSOKGWSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | (E)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid |
| InChIKey | WORYXBDHTBWLLL-VOTSOKGWSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
trans-3-(4-Methoxybenzoyl)acrylic acid, 4-(4-methoxyphenyl)-4-oxobut-2-enoic acid, (E)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid, (2E)-4-(4-Methoxyphenyl)-4-oxo-2-butenoic acid, (2E)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid, 4-(4-Methoxyphenyl)-4-oxo-2-butenoic acid, (E)-4-(4-Methoxyphenyl)-4-oxo-2-butenoic Acid, Acrylic acid, 3-(p-methoxybenzoyl)-, 3-(p-Methoxybenzoyl)acrylic acid, 4-(4-Methoxyphenyl)-4-oxo-buten-2-saeure