Products 20972-37-6
CAS 20972-37-6 appears in our catalog under these names: (2E)-4-(4-Methoxyphenyl)-4-oxo-2-butenoic acid, 95%, 95%, (E)-4-(4-Methoxyphenyl)-4-oxobut-2-enoic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg.
(E)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid (CAS 20972-37-6) is a chemical compound with the molecular formula C11H10O4 and a molecular weight of 206.19 g/mol. IUPAC name: (E)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid. InChIKey: WORYXBDHTBWLLL-VOTSOKGWSA-N.
| Molecular formula | C11H10O4 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | (E)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid |
| InChIKey | WORYXBDHTBWLLL-VOTSOKGWSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
trans-3-(4-Methoxybenzoyl)acrylic acid, 4-(4-methoxyphenyl)-4-oxobut-2-enoic acid, (E)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid, (2E)-4-(4-Methoxyphenyl)-4-oxo-2-butenoic acid, (2E)-4-(4-methoxyphenyl)-4-oxobut-2-enoic acid, 4-(4-Methoxyphenyl)-4-oxo-2-butenoic acid, (E)-4-(4-Methoxyphenyl)-4-oxo-2-butenoic Acid, Acrylic acid, 3-(p-methoxybenzoyl)-, 3-(p-Methoxybenzoyl)acrylic acid, 4-(4-Methoxyphenyl)-4-oxo-buten-2-saeure