cas: 6149-33-3 — see every product listed under this CAS number, including other names
4-(4-Nitrophenoxy)aniline, 95+%, 95+% (CAS 6149-33-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114K5Q-1g |
| cas | 6149-33-3 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 208.40 Pln | |
| Chemat | 25g | 467.60 Pln | |
| Chemat | 100g | 1538.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
4-(4-nitrophenoxy)aniline (CAS 6149-33-3) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 4-(4-nitrophenoxy)aniline. InChIKey: ASAOLTVUTGZJST-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 4-(4-nitrophenoxy)aniline |
| InChIKey | ASAOLTVUTGZJST-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)