cas: 148505-45-7 — see every product listed under this CAS number, including other names
4-(4-Nitrophenoxy)piperidine hydrochloride, 97% (CAS 148505-45-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A802111-100mg |
| cas | 148505-45-7 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 493.15 Pln | |
| AmBeed | 5g | 3539.83 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(4-nitrophenoxy)piperidine;hydrochloride (CAS 148505-45-7) is a chemical compound with the molecular formula C11H15ClN2O3 and a molecular weight of 258.70 g/mol. IUPAC name: 4-(4-nitrophenoxy)piperidine;hydrochloride. InChIKey: VIAOUXPCADEEEG-UHFFFAOYSA-N.
| Molecular formula | C11H15ClN2O3 |
|---|---|
| Molecular weight | 258.70 g/mol |
| IUPAC name | 4-(4-nitrophenoxy)piperidine;hydrochloride |
| InChIKey | VIAOUXPCADEEEG-UHFFFAOYSA-N |
| SMILES | C1CNCCC1OC2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)