cas: 249292-44-2 — see every product listed under this CAS number, including other names
4-(6-OXO-1,6-DIHYDROPYRIDAZIN-3-YL)BENZOIC ACID, 97%, 97% (CAS 249292-44-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120FRQ-100mg |
| cas | 249292-44-2 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1096.40 Pln | |
| Chemat | 250mg | 1782.80 Pln | |
| Chemat | 1g | 3506.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-(6-oxo-1H-pyridazin-3-yl)benzoic acid (CAS 249292-44-2) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 4-(6-oxo-1H-pyridazin-3-yl)benzoic acid. InChIKey: VOCMUCJYMGABRT-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 4-(6-oxo-1H-pyridazin-3-yl)benzoic acid |
| InChIKey | VOCMUCJYMGABRT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNC(=O)C=C2)C(=O)O |
Computed by PubChem (NCBI)