CAS 87769-67-3 appears in our catalog under these names: 3-Hydroxy-6-phenyl-pyridazine-4-carboxylic acid, 95%, 3–Oxo–6–phenyl–2,3–dihydropyridazine–4–carboxylic acid, 3-Oxo-6-phenyl-2,3-dihydro-4-pyridazinecarboxylic acid, 3-Oxo-6-phenyl-2,3-dihydropyridazine-4-carboxylic acid, 97%, 97%, 3-Oxo-6-phenyl-2,3-dihydro-4-pyridazinec, arboxylic acid, 50 mg. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Roth. Available pack sizes: 1g, 250mg, 100mg, 50mg, 5g.
6-oxo-3-phenyl-1H-pyridazine-5-carboxylic acid (CAS 87769-67-3) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 6-oxo-3-phenyl-1H-pyridazine-5-carboxylic acid. InChIKey: PWPFONMCUWVZRW-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 6-oxo-3-phenyl-1H-pyridazine-5-carboxylic acid |
| InChIKey | PWPFONMCUWVZRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC(=O)C(=C2)C(=O)O |
Computed by PubChem (NCBI)