cas: 71398-48-6 — see every product listed under this CAS number, including other names
4-(Aminomethyl)-N,N-dimethylbenzene-1-sulfonamide hydrochloride, 95%+, 95%+ (CAS 71398-48-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IX5V-100mg |
| cas | 71398-48-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 1163.60 Pln | |
| Chemat | 1g | 3506.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
N,N-dimethyl-4-(methylamino)benzenesulfonamide (CAS 71398-48-6) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: N,N-dimethyl-4-(methylamino)benzenesulfonamide. InChIKey: GZPBMGVKWGJDIF-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | N,N-dimethyl-4-(methylamino)benzenesulfonamide |
| InChIKey | GZPBMGVKWGJDIF-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)