CAS 77812-86-3 is the registry number for N,N-Dimethyl-4-(methylamino)benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
N,N-dimethyl-4-(methylamino)benzenesulfonamide (CAS 77812-86-3) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: N,N-dimethyl-4-(methylamino)benzenesulfonamide. InChIKey: GZPBMGVKWGJDIF-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | N,N-dimethyl-4-(methylamino)benzenesulfonamide |
| InChIKey | GZPBMGVKWGJDIF-UHFFFAOYSA-N |
| SMILES | CNC1=CC=C(C=C1)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)