cas: 185346-79-6 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-1-bromo-2-fluorobenzene 98% (CAS 185346-79-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A506795-5g |
| cas | 185346-79-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 25g | 592.88 Pln | |
| Ambeed | 100g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A506795 |
1-bromo-2-fluoro-4-phenylmethoxybenzene (CAS 185346-79-6) is a chemical compound with the molecular formula C13H10BrFO and a molecular weight of 281.12 g/mol. IUPAC name: 1-bromo-2-fluoro-4-phenylmethoxybenzene. InChIKey: BYTJTXKQBSNGCL-UHFFFAOYSA-N.
| Molecular formula | C13H10BrFO |
|---|---|
| Molecular weight | 281.12 g/mol |
| IUPAC name | 1-bromo-2-fluoro-4-phenylmethoxybenzene |
| InChIKey | BYTJTXKQBSNGCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)