CAS 1262133-20-9 is the registry number for 4-(Benzyloxy)-2,6-dichloropyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg.
2,6-dichloro-4-phenylmethoxypyridine (CAS 1262133-20-9) is a chemical compound with the molecular formula C12H9Cl2NO and a molecular weight of 254.11 g/mol. IUPAC name: 2,6-dichloro-4-phenylmethoxypyridine. InChIKey: ZQQFOHVNHOYXQN-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl2NO |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 2,6-dichloro-4-phenylmethoxypyridine |
| InChIKey | ZQQFOHVNHOYXQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=NC(=C2)Cl)Cl |
Computed by PubChem (NCBI)