cas: 289662-11-9 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-3,5-dichlorobenzaldehyde (CAS 289662-11-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F617899-1G |
| cas | 289662-11-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2892.75 Pln | |
| Fluorochem | 5g | 8547.01 Pln |
| delivery time | 3-4 weeks |
|---|
3,5-dichloro-4-phenylmethoxybenzaldehyde (CAS 289662-11-9) is a chemical compound with the molecular formula C14H10Cl2O2 and a molecular weight of 281.1 g/mol. IUPAC name: 3,5-dichloro-4-phenylmethoxybenzaldehyde. InChIKey: MOEUXDGQMNVPHZ-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O2 |
|---|---|
| Molecular weight | 281.1 g/mol |
| IUPAC name | 3,5-dichloro-4-phenylmethoxybenzaldehyde |
| InChIKey | MOEUXDGQMNVPHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Cl)C=O)Cl |
Computed by PubChem (NCBI)