cas: 289662-11-9 — see every product listed under this CAS number, including other names
4-Benzyloxy-3,5-dichlorobenzaldehyde, ≥95%, ≥95% (CAS 289662-11-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BM2W-1g |
| cas | 289662-11-9 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1763.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
3,5-dichloro-4-phenylmethoxybenzaldehyde (CAS 289662-11-9) is a chemical compound with the molecular formula C14H10Cl2O2 and a molecular weight of 281.1 g/mol. IUPAC name: 3,5-dichloro-4-phenylmethoxybenzaldehyde. InChIKey: MOEUXDGQMNVPHZ-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O2 |
|---|---|
| Molecular weight | 281.1 g/mol |
| IUPAC name | 3,5-dichloro-4-phenylmethoxybenzaldehyde |
| InChIKey | MOEUXDGQMNVPHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2Cl)C=O)Cl |
Computed by PubChem (NCBI)