cas: 106931-79-7 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-3-chlorobenzoic acid 95+% (CAS 106931-79-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A343586-250mg |
| cas | 106931-79-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 2217.12 Pln | |
| Ambeed | 10g | 3735.69 Pln | |
| Ambeed | 25g | 7295.69 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A343586 |
3-chloro-4-phenylmethoxybenzoic acid (CAS 106931-79-7) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 3-chloro-4-phenylmethoxybenzoic acid. InChIKey: MQUAYIQAPMFLCC-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 3-chloro-4-phenylmethoxybenzoic acid |
| InChIKey | MQUAYIQAPMFLCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)