Products 1181237-76-2

CAS 1181237-76-2 is the registry number for 3'-Chloro-4'-methoxybiphenyl-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(3-chloro-4-methoxyphenyl)benzoic acid (CAS 1181237-76-2) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 3-(3-chloro-4-methoxyphenyl)benzoic acid. InChIKey: OMNGOBJTDWDOJT-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11ClO3
Molecular weight262.69 g/mol
IUPAC name3-(3-chloro-4-methoxyphenyl)benzoic acid
InChIKeyOMNGOBJTDWDOJT-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C2=CC(=CC=C2)C(=O)O)Cl

Computed by PubChem (NCBI)