4-(Benzyloxy)-3-chlorobenzoic acid, 95+%
cas: 106931-79-7 — see every product listed under this CAS number, including other names
4-(Benzyloxy)-3-chlorobenzoic acid, 95+% (CAS 106931-79-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A343586-250mg |
| cas | 106931-79-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 676.31 Pln | |
| Ambeed | 5g | 2239.38 Pln | |
| Ambeed | 10g | 3774.62 Pln | |
| Ambeed | 25g | 7373.56 Pln | |
| BLDpharm | 250mg | 386.56 Pln | |
| BLDpharm | 1g | 725.32 Pln | |
| BLDpharm | 5g | 2408.07 Pln | |
| BLDpharm | 10g | 4063.04 Pln | |
| BLDpharm | 25g | 7945.00 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
3-chloro-4-phenylmethoxybenzoic acid (CAS 106931-79-7) is a chemical compound with the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. IUPAC name: 3-chloro-4-phenylmethoxybenzoic acid. InChIKey: MQUAYIQAPMFLCC-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO3 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 3-chloro-4-phenylmethoxybenzoic acid |
| InChIKey | MQUAYIQAPMFLCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)