CAS 90172-60-4 is the registry number for (4-Fluorophenyl)(indolin-1-yl)methanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dihydroindol-1-yl-(4-fluorophenyl)methanone (CAS 90172-60-4) is a chemical compound with the molecular formula C15H12FNO and a molecular weight of 241.26 g/mol. IUPAC name: 2,3-dihydroindol-1-yl-(4-fluorophenyl)methanone. InChIKey: FZMVZJOCYNSJOF-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO |
|---|---|
| Molecular weight | 241.26 g/mol |
| IUPAC name | 2,3-dihydroindol-1-yl-(4-fluorophenyl)methanone |
| InChIKey | FZMVZJOCYNSJOF-UHFFFAOYSA-N |
| SMILES | C1CN(C2=CC=CC=C21)C(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)