CAS 931735-11-4 is the registry number for 3-(2-fluorobenzyl)-1,3-dihydroindol-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
3-[(2-fluorophenyl)methyl]-1,3-dihydroindol-2-one (CAS 931735-11-4) is a chemical compound with the molecular formula C15H12FNO and a molecular weight of 241.26 g/mol. IUPAC name: 3-[(2-fluorophenyl)methyl]-1,3-dihydroindol-2-one. InChIKey: FYRXYFBKFLKHMC-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO |
|---|---|
| Molecular weight | 241.26 g/mol |
| IUPAC name | 3-[(2-fluorophenyl)methyl]-1,3-dihydroindol-2-one |
| InChIKey | FYRXYFBKFLKHMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2C3=CC=CC=C3NC2=O)F |
Computed by PubChem (NCBI)