CAS 25893-50-9 appears in our catalog under these names: N–(2–Fluorophenyl)cinnamamide, N-(2-Fluorophenyl)-3-phenylacrylamide 95%, (2E)-N-(2-fluorophenyl)-3-phenylprop-2-enamide, 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 1g.
(E)-N-(2-fluorophenyl)-3-phenylprop-2-enamide (CAS 25893-50-9) is a chemical compound with the molecular formula C15H12FNO and a molecular weight of 241.26 g/mol. IUPAC name: (E)-N-(2-fluorophenyl)-3-phenylprop-2-enamide. InChIKey: GFAVMCPSQILRPK-ZHACJKMWSA-N.
| Molecular formula | C15H12FNO |
|---|---|
| Molecular weight | 241.26 g/mol |
| IUPAC name | (E)-N-(2-fluorophenyl)-3-phenylprop-2-enamide |
| InChIKey | GFAVMCPSQILRPK-ZHACJKMWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NC2=CC=CC=C2F |
Computed by PubChem (NCBI)