CAS 175204-09-8 is the registry number for 2-Fluoro-6-(4-methylbenzyloxy)benzonitrile. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
2-fluoro-6-[(4-methylphenyl)methoxy]benzonitrile (CAS 175204-09-8) is a chemical compound with the molecular formula C15H12FNO and a molecular weight of 241.26 g/mol. IUPAC name: 2-fluoro-6-[(4-methylphenyl)methoxy]benzonitrile. InChIKey: PYDSAKVFHVQAAD-UHFFFAOYSA-N.
| Molecular formula | C15H12FNO |
|---|---|
| Molecular weight | 241.26 g/mol |
| IUPAC name | 2-fluoro-6-[(4-methylphenyl)methoxy]benzonitrile |
| InChIKey | PYDSAKVFHVQAAD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)COC2=C(C(=CC=C2)F)C#N |
Computed by PubChem (NCBI)