cas: 411229-67-9 — see every product listed under this CAS number, including other names
4-(Cyclopropylmethoxy)phenylboronic acid, 95-<97% (CAS 411229-67-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC528-95-97-10g |
| cas | 411229-67-9 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 3230.04 Pln | |
| Hoffman Fine Chemicals | 25g | 5628.92 Pln | |
| Hoffman Fine Chemicals | 50g | 8818.92 Pln | |
| Hoffman Fine Chemicals | 100g | 13922.92 Pln | |
| Hoffman Fine Chemicals | 200g | 22095.70 Pln | |
| Hoffman Fine Chemicals | 300g | 28086.52 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
[4-(cyclopropylmethoxy)phenyl]boronic acid (CAS 411229-67-9) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: [4-(cyclopropylmethoxy)phenyl]boronic acid. InChIKey: AYJVDOMUBHORKK-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | [4-(cyclopropylmethoxy)phenyl]boronic acid |
| InChIKey | AYJVDOMUBHORKK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2CC2)(O)O |
Computed by PubChem (NCBI)