4-(Decyloxy)benzoic acid, 98%
cas: 5519-23-3 — see every product listed under this CAS number, including other names
4-(Decyloxy)benzoic acid, 98% (CAS 5519-23-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 250mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A113128-1g |
| cas | 5519-23-3 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 25g | 676.31 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 25g | 712.40 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 275.48 Pln | |
| BLDpharm | 25g | 725.32 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
4-decoxybenzoic acid (CAS 5519-23-3) is a chemical compound with the molecular formula C17H26O3 and a molecular weight of 278.4 g/mol. IUPAC name: 4-decoxybenzoic acid. InChIKey: NZNICZRIRMGOFG-UHFFFAOYSA-N.
| Molecular formula | C17H26O3 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | 4-decoxybenzoic acid |
| InChIKey | NZNICZRIRMGOFG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)