Products 63258-18-4

CAS 63258-18-4 is the registry number for Gemfibrozil Ethyl Ester. Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Ethyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate (CAS 63258-18-4) is a chemical compound with the molecular formula C17H26O3 and a molecular weight of 278.4 g/mol. IUPAC name: ethyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate. InChIKey: JHYZJKNPRVDWIT-UHFFFAOYSA-N.

Identity
Molecular formulaC17H26O3
Molecular weight278.4 g/mol
IUPAC nameethyl 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoate
InChIKeyJHYZJKNPRVDWIT-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)(C)CCCOC1=C(C=CC(=C1)C)C

Computed by PubChem (NCBI)