CAS 19672-49-2 appears in our catalog under these names: 4–(Hydroxydiphenylmethyl)benzoic acid, 4-(DIPHENYLHYDROXYMETHYL)BENZOIC ACID, &, 4-(Hydroxydiphenylmethyl)benzoic acid, 98%, 98%, 4-(Diphenylhydroxymethyl)benzoic acid, 98%. Offered by: GLPBio, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 50g, 100mg, 25g, 100g.
4-[hydroxy(diphenyl)methyl]benzoic acid (CAS 19672-49-2) is a chemical compound with the molecular formula C20H16O3 and a molecular weight of 304.3 g/mol. IUPAC name: 4-[hydroxy(diphenyl)methyl]benzoic acid. InChIKey: CPZWBWPALJLUBJ-UHFFFAOYSA-N.
| Molecular formula | C20H16O3 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 4-[hydroxy(diphenyl)methyl]benzoic acid |
| InChIKey | CPZWBWPALJLUBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)C(=O)O)O |
Computed by PubChem (NCBI)