cas: 203453-80-9 — see every product listed under this CAS number, including other names
4-(Fmoc-2-aminoethyl)benzoic acid, 98%, 98% (CAS 203453-80-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I4TY-1g |
| cas | 203453-80-9 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1653.20 Pln | |
| Chemat | 5g | 4821.20 Pln | |
| Chemat | 10g | 7984.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]benzoic acid (CAS 203453-80-9) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]benzoic acid. InChIKey: BYXHJLWUYIRBIB-UHFFFAOYSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]benzoic acid |
| InChIKey | BYXHJLWUYIRBIB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)