CAS 203453-80-9 appears in our catalog under these names: 4-(Fmoc-2-aminoethyl)-benzoic acid, 98%, 4-(Fmoc-2-aminoethyl)benzoic acid, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g.
4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]benzoic acid (CAS 203453-80-9) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]benzoic acid. InChIKey: BYXHJLWUYIRBIB-UHFFFAOYSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]benzoic acid |
| InChIKey | BYXHJLWUYIRBIB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)